Copy and Edit

Shampoo

Description

Shampoo
kavindi23
Mind Map by kavindi23, updated more than 1 year ago
kavindi23
Created by kavindi23 over 9 years ago
17
0
0

Resource summary

Shampoo
  1. Affects the
    1. ENVIRONMENT
      1. Groundwater Supplies
        2. Potential Bioaccumilation
          1. Seeps into the environment in large quantities.
            1. Threatening
              1. Fish and other aquatic organisms.
          2. Plastic Pollution
        3. Affects
          1. BODY SYSTEMS
            1. Integumentary System
              1. Functions as a penetration enhancer and can allow harmful ingredients to be absorbed more readily through the skin.
                1. Proven skin irritant.
                2. Nervous System
                  1. CNS - Central Nervous System
                    1. Brain
                      1. Spinal Cord
                    2. Digestive System
                      1. Liver
                      2. Excretory System
                        1. Kidneys
                        2. Endocrine System
                          1. Breast Cancer
                            1. Hormone Function
                            2. Skeletal System
                              1. Bone Cancer
                          2. Affects
                            1. SOCIETY
                              1. The "No Poo" Movement
                                1. People rejecting the societal norm of frequent shampoo use. Instead opt for using only water, or more natural alternatives like baking soda.
                                  1. Why?
                                    1. Pollution
                                      1. Shampoo containers are often made of plastic, which contributes to plastics pollution
                                      2. Economics
                                        1. It is more cost-effective compared to purchasing commercial hair products
                                        2. The Many, Many Chemical Additives' & Their Effects on the Body
                                2. Has
                                  1. CHEMICALS
                                    1. Such As..
                                      1. Sodium Dodecyl Sulfate
                                        1. Molecular formula: NaC12H25SO4
                                          1. A common component of many domestic cleaning products.
                                            1. Proven skin irritant.
                                              1. Can be contaminated wih traces of...
                                              2. Sodium Laureth Sulfate
                                                1. Molecular formula: CH3(CH2)11(OCH2CH2)nOSO3Na
                                                  2. Polyethylene Glycol (PEG)
                                                    1. Molecular formula: C2nH4n+2On+1
                                                      1. Petroleum-based compound that are widely used in cosmetics as thickeners, solvents, softeners, and moisture-carriers.
                                                        1. Often Contaminated with
                                                          1. 1,4-Dioxane
                                                            1. Molecular Formula: C4H8O2
                                                              1. Damages
                                                                1. CNS -Central Nervous System
                                                                  1. Liver
                                                                    2. Classified by The International Agency for Research on Cancer as a Group 2B carcinogen: possibly carcinogenic to humans.
                                                                      1. 1,4-Dioxane doesn't easily degrade and can remain in the environment long after it is rinsed down the shower drain.
                                                                        1. Groundwater Supplies
                                                                          1. Affecting...
                                                                            1. Resulting in...
                                                                              1. The FDA encourages manufacturers to remove 1,4-dioxane, however, it is not required by federal law.
                                                                                1. Steps towards removing carcinogenic chemical
                                                                                  1. SOCIETY
                                                                                    1. Degradation of Groundwater Supplies
                                                                                      1. A precious resource for rural families and businesses. Sometimes the only water source.
                                                                              2. Ethylene Oxide
                                                                                1. Molecular Formula: C2H4O
                                                                                  1. The International Agency for Research on Cancer (IARC) classifies ethylene oxide into group 1, meaning it is a proven carcinogen.
                                                                                    1. Linked to...
                                                                                      1. Breast Cancer
                                                                                        1. Bone
                                                                                          1. Interference with Human Growth
                                                                                            1. Brain
                                                                                  3. Cyclopentasiloxane (also called D5)
                                                                                    1. Molecular formula: C10H30O5Si5
                                                                                      1. Interferes with...
                                                                                        1. Hormone Function
                                                                                          1. Kidney Health
                                                                                        2. Both D5 and D4 are very prevalent substancesused to make industrial products, including textiles, paints and plastics.
                                                                                        3. Cyclotetrasiloxane (also called D4)
                                                                                          1. Molecular Formula: C7H22O4Si4

                                                                                      Media attachments

                                                                                      Show full summary Hide full summary

                                                                                      Want to create your own Mind Maps for free with GoConqr? Learn more.

                                                                                      Similar

                                                                                      Personal Care Products
                                                                                      Jay Flood
                                                                                      Nazi Germany Dates
                                                                                      Georgina.Smith
                                                                                      Forces and their effects
                                                                                      kate.siena
                                                                                      Respiratory System
                                                                                      Addeana
                                                                                      B3- Science. Cells, Genes and Enzymes.
                                                                                      MissChurro
                                                                                      Hitlers Germany
                                                                                      gursharonkaur15
                                                                                      Biological Definitions
                                                                                      Yamminnnn
                                                                                      History - Germany 1918 - 1945
                                                                                      Grace Evans
                                                                                      Mind Maps with GoConqr
                                                                                      Manikandan Achan
                                                                                      Primary School Mathematics
                                                                                      lara.greenberg
                                                                                      AAHI_Card set 2 (Escalation criteria)
                                                                                      Tafe Teachers SB
                                                                                      Browse Library